About 9-[4-carbazol-9-yl-6-(2-phenylpyrimidin-5-yl)-1,3,5-triazin-2-yl]carbazole
9-[4-carbazol-9-yl-6-(2-phenylpyrimidin-5-yl)-1,3,5-triazin-2-yl]carbazole (PubChem CID 59194538) has the molecular formula C37H23N7
and a molecular weight of 565.64 g/mol. Its IUPAC name is 9-[4-carbazol-9-yl-6-(2-phenylpyrimidin-5-yl)-1,3,5-triazin-2-yl]carbazole.
Molecular Properties
| Compound Name | 9-[4-carbazol-9-yl-6-(2-phenylpyrimidin-5-yl)-1,3,5-triazin-2-yl]carbazole |
| PubChem CID | 59194538 |
| Molecular Formula | C37H23N7 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 9-[4-carbazol-9-yl-6-(2-phenylpyrimidin-5-yl)-1,3,5-triazin-2-yl]carbazole |
| SMILES | c1ccc(-c2ncc(-c3nc(-n4c5ccccc5c5ccccc54)nc(-n4c5ccccc5c5ccccc54)n3)cn2)cc1 |
| InChI | InChI=1S/C37H23N7/c1-2-12-24(13-3-1)34-38-22-25(23-39-34)35-40-36(43-30-18-8-4-14-26(30)27-15-5-9-19-31(27)43)42-37(41-35)44-32-20-10-6-16-28(32)29-17-7-11-21-33(29)44/h1-23H |
| InChIKey | HSNMMIOVKVNCLM-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 9-[4-carbazol-9-yl-6-(2-phenylpyrimidin-5-yl)-1,3,5-triazin-2-yl]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[4-carbazol-9-yl-6-(2-phenylpyrimidin-5-yl)-1,3,5-triazin-2-yl]carbazole?
The IUPAC name of 9-[4-carbazol-9-yl-6-(2-phenylpyrimidin-5-yl)-1,3,5-triazin-2-yl]carbazole (CID 59194538) is 9-[4-carbazol-9-yl-6-(2-phenylpyrimidin-5-yl)-1,3,5-triazin-2-yl]carbazole.
What is the SMILES notation for 9-[4-carbazol-9-yl-6-(2-phenylpyrimidin-5-yl)-1,3,5-triazin-2-yl]carbazole?
The canonical SMILES for 9-[4-carbazol-9-yl-6-(2-phenylpyrimidin-5-yl)-1,3,5-triazin-2-yl]carbazole is c1ccc(-c2ncc(-c3nc(-n4c5ccccc5c5ccccc54)nc(-n4c5ccccc5c5ccccc54)n3)cn2)cc1.
What is the InChIKey of 9-[4-carbazol-9-yl-6-(2-phenylpyrimidin-5-yl)-1,3,5-triazin-2-yl]carbazole?
The InChIKey is HSNMMIOVKVNCLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H23N7/c1-2-12-24(13-3-1)34-38-22-25(23-39-34)35-40-36(43-30-18-8-4-14-26(30)27-15-5-9-19-31(27)43)42-37(41-35)44-32-20-10-6-16-28(32)29-17-7-11-21-33(29)44/h1-23H.
What are the key properties of 9-[4-carbazol-9-yl-6-(2-phenylpyrimidin-5-yl)-1,3,5-triazin-2-yl]carbazole?
9-[4-carbazol-9-yl-6-(2-phenylpyrimidin-5-yl)-1,3,5-triazin-2-yl]carbazole has a molecular weight of 565.64 g/mol, XLogP of 8.19, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[4-carbazol-9-yl-6-(2-phenylpyrimidin-5-yl)-1,3,5-triazin-2-yl]carbazole is sourced from PubChem (CID 59194538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).