About 5-chloro-3-methyl-1H-pyrrole-2,4-dicarbaldehyde
5-chloro-3-methyl-1H-pyrrole-2,4-dicarbaldehyde (PubChem CID 59196761) has the molecular formula C7H6ClNO2
and a molecular weight of 171.58 g/mol. Its IUPAC name is 5-chloro-3-methyl-1H-pyrrole-2,4-dicarbaldehyde.
Molecular Properties
| Compound Name | 5-chloro-3-methyl-1H-pyrrole-2,4-dicarbaldehyde |
| PubChem CID | 59196761 |
| Molecular Formula | C7H6ClNO2 |
| Molecular Weight | 171.58 g/mol |
| Exact Mass | 171.01 |
| IUPAC Name | 5-chloro-3-methyl-1H-pyrrole-2,4-dicarbaldehyde |
| SMILES | Cc1c(C=O)[nH]c(Cl)c1C=O |
| InChI | InChI=1S/C7H6ClNO2/c1-4-5(2-10)7(8)9-6(4)3-11/h2-3,9H,1H3 |
| InChIKey | BIGDZNFOWVEOAR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.58 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-methyl-1H-pyrrole-2,4-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-methyl-1H-pyrrole-2,4-dicarbaldehyde?
The IUPAC name of 5-chloro-3-methyl-1H-pyrrole-2,4-dicarbaldehyde (CID 59196761) is 5-chloro-3-methyl-1H-pyrrole-2,4-dicarbaldehyde.
What is the SMILES notation for 5-chloro-3-methyl-1H-pyrrole-2,4-dicarbaldehyde?
The canonical SMILES for 5-chloro-3-methyl-1H-pyrrole-2,4-dicarbaldehyde is Cc1c(C=O)[nH]c(Cl)c1C=O.
What is the InChIKey of 5-chloro-3-methyl-1H-pyrrole-2,4-dicarbaldehyde?
The InChIKey is BIGDZNFOWVEOAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO2/c1-4-5(2-10)7(8)9-6(4)3-11/h2-3,9H,1H3.
What are the key properties of 5-chloro-3-methyl-1H-pyrrole-2,4-dicarbaldehyde?
5-chloro-3-methyl-1H-pyrrole-2,4-dicarbaldehyde has a molecular weight of 171.58 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-methyl-1H-pyrrole-2,4-dicarbaldehyde is sourced from PubChem (CID 59196761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).