About 4-(4-methoxyphenyl)-N,N-bis[4-(4-methoxyphenyl)phenyl]aniline
4-(4-methoxyphenyl)-N,N-bis[4-(4-methoxyphenyl)phenyl]aniline (PubChem CID 59196803) has the molecular formula C39H33NO3
and a molecular weight of 563.70 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N,N-bis[4-(4-methoxyphenyl)phenyl]aniline.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-N,N-bis[4-(4-methoxyphenyl)phenyl]aniline |
| PubChem CID | 59196803 |
| Molecular Formula | C39H33NO3 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | 4-(4-methoxyphenyl)-N,N-bis[4-(4-methoxyphenyl)phenyl]aniline |
| SMILES | COc1ccc(-c2ccc(N(c3ccc(-c4ccc(OC)cc4)cc3)c3ccc(-c4ccc(OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H33NO3/c1-41-37-22-10-31(11-23-37)28-4-16-34(17-5-28)40(35-18-6-29(7-19-35)32-12-24-38(42-2)25-13-32)36-20-8-30(9-21-36)33-14-26-39(43-3)27-15-33/h4-27H,1-3H3 |
| InChIKey | DWMVVARYAFLTHT-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-methoxyphenyl)-N,N-bis[4-(4-methoxyphenyl)phenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-N,N-bis[4-(4-methoxyphenyl)phenyl]aniline?
The IUPAC name of 4-(4-methoxyphenyl)-N,N-bis[4-(4-methoxyphenyl)phenyl]aniline (CID 59196803) is 4-(4-methoxyphenyl)-N,N-bis[4-(4-methoxyphenyl)phenyl]aniline.
What is the SMILES notation for 4-(4-methoxyphenyl)-N,N-bis[4-(4-methoxyphenyl)phenyl]aniline?
The canonical SMILES for 4-(4-methoxyphenyl)-N,N-bis[4-(4-methoxyphenyl)phenyl]aniline is COc1ccc(-c2ccc(N(c3ccc(-c4ccc(OC)cc4)cc3)c3ccc(-c4ccc(OC)cc4)cc3)cc2)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-N,N-bis[4-(4-methoxyphenyl)phenyl]aniline?
The InChIKey is DWMVVARYAFLTHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H33NO3/c1-41-37-22-10-31(11-23-37)28-4-16-34(17-5-28)40(35-18-6-29(7-19-35)32-12-24-38(42-2)25-13-32)36-20-8-30(9-21-36)33-14-26-39(43-3)27-15-33/h4-27H,1-3H3.
What are the key properties of 4-(4-methoxyphenyl)-N,N-bis[4-(4-methoxyphenyl)phenyl]aniline?
4-(4-methoxyphenyl)-N,N-bis[4-(4-methoxyphenyl)phenyl]aniline has a molecular weight of 563.70 g/mol, XLogP of 10.18, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-N,N-bis[4-(4-methoxyphenyl)phenyl]aniline is sourced from PubChem (CID 59196803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).