C60H45NO3 — CID 59196876
4-[3-(4-ethenylphenoxy)phenyl]-N,N-bis[4-[3-(4-ethenylphenoxy)phenyl]phenyl]aniline (PubChem CID 59196876) has the molecular formula C60H45NO3 and a molecular weight of 828.02 g/mol. Its IUPAC name is 4-[3-(4-ethenylphenoxy)phenyl]-N,N-bis[4-[3-(4-ethenylphenoxy)phenyl]phenyl]aniline.
| Compound Name | 4-[3-(4-ethenylphenoxy)phenyl]-N,N-bis[4-[3-(4-ethenylphenoxy)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 59196876 |
| Molecular Formula | C60H45NO3 |
| Molecular Weight | 828.02 g/mol |
| Exact Mass | 827.34 |
| IUPAC Name | 4-[3-(4-ethenylphenoxy)phenyl]-N,N-bis[4-[3-(4-ethenylphenoxy)phenyl]phenyl]aniline |
| SMILES | C=Cc1ccc(Oc2cccc(-c3ccc(N(c4ccc(-c5cccc(Oc6ccc(C=C)cc6)c5)cc4)c4ccc(-c5cccc(Oc6ccc(C=C)cc6)c5)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C60H45NO3/c1-4-43-16-34-55(35-17-43)62-58-13-7-10-49(40-58)46-22-28-52(29-23-46)61(53-30-24-47(25-31-53)50-11-8-14-59(41-50)63-56-36-18-44(5-2)19-37-56)54-32-26-48(27-33-54)51-12-9-15-60(42-51)64-57-38-20-45(6-3)21-39-57/h4-42H,1-3H2 |
| InChIKey | PSNIVQQZVUYDKF-UHFFFAOYSA-N |
| XLogP | 17.46 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.02 |
| LogP ≤ 5 | 17.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |