C10H11NS — CID 59197119
3,5,6-trimethyl-2,1-benzothiazole (PubChem CID 59197119) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is 3,5,6-trimethyl-2,1-benzothiazole.
| Compound Name | 3,5,6-trimethyl-2,1-benzothiazole |
|---|---|
| PubChem CID | 59197119 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 3,5,6-trimethyl-2,1-benzothiazole |
| SMILES | Cc1cc2nsc(C)c2cc1C |
| InChI | InChI=1S/C10H11NS/c1-6-4-9-8(3)12-11-10(9)5-7(6)2/h4-5H,1-3H3 |
| InChIKey | KTLLRTOWFQPHLA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |