C27H33NO — CID 59197200
(3S,10R,13S)-17-indol-1-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 59197200) has the molecular formula C27H33NO and a molecular weight of 387.57 g/mol. Its IUPAC name is (3S,10R,13S)-17-indol-1-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10R,13S)-17-indol-1-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 59197200 |
| Molecular Formula | C27H33NO |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | (3S,10R,13S)-17-indol-1-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H](O)CC1=CCC1C2CC[C@]2(C)C(n3ccc4ccccc43)=CCC12 |
| InChI | InChI=1S/C27H33NO/c1-26-14-11-20(29)17-19(26)7-8-21-22-9-10-25(27(22,2)15-12-23(21)26)28-16-13-18-5-3-4-6-24(18)28/h3-7,10,13,16,20-23,29H,8-9,11-12,14-15,17H2,1-2H3/t20-,21?,22?,23?,26-,27-/m0/s1 |
| InChIKey | RNCPUPGYLFULQH-PVZVGWETSA-N |
| XLogP | 6.42 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|