About 3-methyl-2,5-bis[2-(4-methylphenyl)ethynyl]thiophene
3-methyl-2,5-bis[2-(4-methylphenyl)ethynyl]thiophene (PubChem CID 59197258) has the molecular formula C23H18S
and a molecular weight of 326.46 g/mol. Its IUPAC name is 3-methyl-2,5-bis[2-(4-methylphenyl)ethynyl]thiophene.
Molecular Properties
| Compound Name | 3-methyl-2,5-bis[2-(4-methylphenyl)ethynyl]thiophene |
| PubChem CID | 59197258 |
| Molecular Formula | C23H18S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 3-methyl-2,5-bis[2-(4-methylphenyl)ethynyl]thiophene |
| SMILES | Cc1ccc(C#Cc2cc(C)c(C#Cc3ccc(C)cc3)s2)cc1 |
| InChI | InChI=1S/C23H18S/c1-17-4-8-20(9-5-17)12-14-22-16-19(3)23(24-22)15-13-21-10-6-18(2)7-11-21/h4-11,16H,1-3H3 |
| InChIKey | BBVMUIOTRXVLOY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2,5-bis[2-(4-methylphenyl)ethynyl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,5-bis[2-(4-methylphenyl)ethynyl]thiophene?
The IUPAC name of 3-methyl-2,5-bis[2-(4-methylphenyl)ethynyl]thiophene (CID 59197258) is 3-methyl-2,5-bis[2-(4-methylphenyl)ethynyl]thiophene.
What is the SMILES notation for 3-methyl-2,5-bis[2-(4-methylphenyl)ethynyl]thiophene?
The canonical SMILES for 3-methyl-2,5-bis[2-(4-methylphenyl)ethynyl]thiophene is Cc1ccc(C#Cc2cc(C)c(C#Cc3ccc(C)cc3)s2)cc1.
What is the InChIKey of 3-methyl-2,5-bis[2-(4-methylphenyl)ethynyl]thiophene?
The InChIKey is BBVMUIOTRXVLOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18S/c1-17-4-8-20(9-5-17)12-14-22-16-19(3)23(24-22)15-13-21-10-6-18(2)7-11-21/h4-11,16H,1-3H3.
What are the key properties of 3-methyl-2,5-bis[2-(4-methylphenyl)ethynyl]thiophene?
3-methyl-2,5-bis[2-(4-methylphenyl)ethynyl]thiophene has a molecular weight of 326.46 g/mol, XLogP of 5.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,5-bis[2-(4-methylphenyl)ethynyl]thiophene is sourced from PubChem (CID 59197258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).