C42H55O3P — CID 59197330
1,5-ditert-butyl-2-[(2,4-ditert-butyl-5-methylphenoxy)-(4-phenylphenyl)phosphoryl]oxy-4-methylbenzene (PubChem CID 59197330) has the molecular formula C42H55O3P and a molecular weight of 638.87 g/mol. Its IUPAC name is 1,5-ditert-butyl-2-[(2,4-ditert-butyl-5-methylphenoxy)-(4-phenylphenyl)phosphoryl]oxy-4-methylbenzene.
| Compound Name | 1,5-ditert-butyl-2-[(2,4-ditert-butyl-5-methylphenoxy)-(4-phenylphenyl)phosphoryl]oxy-4-methylbenzene |
|---|---|
| PubChem CID | 59197330 |
| Molecular Formula | C42H55O3P |
| Molecular Weight | 638.87 g/mol |
| Exact Mass | 638.39 |
| IUPAC Name | 1,5-ditert-butyl-2-[(2,4-ditert-butyl-5-methylphenoxy)-(4-phenylphenyl)phosphoryl]oxy-4-methylbenzene |
| SMILES | Cc1cc(OP(=O)(Oc2cc(C)c(C(C)(C)C)cc2C(C)(C)C)c2ccc(-c3ccccc3)cc2)c(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C42H55O3P/c1-28-24-37(35(41(9,10)11)26-33(28)39(3,4)5)44-46(43,32-22-20-31(21-23-32)30-18-16-15-17-19-30)45-38-25-29(2)34(40(6,7)8)27-36(38)42(12,13)14/h15-27H,1-14H3 |
| InChIKey | MKRBUDOHLSBPBW-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.87 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|