About bis(3,4-dimethylphenyl)-bis(trifluoromethyl)-λ4-sulfane
bis(3,4-dimethylphenyl)-bis(trifluoromethyl)-λ4-sulfane (PubChem CID 59197399) has the molecular formula C18H18F6S
and a molecular weight of 380.40 g/mol. Its IUPAC name is bis(3,4-dimethylphenyl)-bis(trifluoromethyl)-λ4-sulfane.
Molecular Properties
| Compound Name | bis(3,4-dimethylphenyl)-bis(trifluoromethyl)-λ4-sulfane |
| PubChem CID | 59197399 |
| Molecular Formula | C18H18F6S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | bis(3,4-dimethylphenyl)-bis(trifluoromethyl)-λ4-sulfane |
| SMILES | Cc1ccc(S(c2ccc(C)c(C)c2)(C(F)(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C18H18F6S/c1-11-5-7-15(9-13(11)3)25(17(19,20)21,18(22,23)24)16-8-6-12(2)14(4)10-16/h5-10H,1-4H3 |
| InChIKey | QUVXZXQGQHKVKB-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(3,4-dimethylphenyl)-bis(trifluoromethyl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3,4-dimethylphenyl)-bis(trifluoromethyl)-λ4-sulfane?
The IUPAC name of bis(3,4-dimethylphenyl)-bis(trifluoromethyl)-λ4-sulfane (CID 59197399) is bis(3,4-dimethylphenyl)-bis(trifluoromethyl)-λ4-sulfane.
What is the SMILES notation for bis(3,4-dimethylphenyl)-bis(trifluoromethyl)-λ4-sulfane?
The canonical SMILES for bis(3,4-dimethylphenyl)-bis(trifluoromethyl)-λ4-sulfane is Cc1ccc(S(c2ccc(C)c(C)c2)(C(F)(F)F)C(F)(F)F)cc1C.
What is the InChIKey of bis(3,4-dimethylphenyl)-bis(trifluoromethyl)-λ4-sulfane?
The InChIKey is QUVXZXQGQHKVKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F6S/c1-11-5-7-15(9-13(11)3)25(17(19,20)21,18(22,23)24)16-8-6-12(2)14(4)10-16/h5-10H,1-4H3.
What are the key properties of bis(3,4-dimethylphenyl)-bis(trifluoromethyl)-λ4-sulfane?
bis(3,4-dimethylphenyl)-bis(trifluoromethyl)-λ4-sulfane has a molecular weight of 380.40 g/mol, XLogP of 7.18, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,4-dimethylphenyl)-bis(trifluoromethyl)-λ4-sulfane is sourced from PubChem (CID 59197399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).