About 2-(2-methylpropoxy)ethyl cyclohexanecarboxylate
2-(2-methylpropoxy)ethyl cyclohexanecarboxylate (PubChem CID 59197441) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is 2-(2-methylpropoxy)ethyl cyclohexanecarboxylate.
Molecular Properties
| Compound Name | 2-(2-methylpropoxy)ethyl cyclohexanecarboxylate |
| PubChem CID | 59197441 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 2-(2-methylpropoxy)ethyl cyclohexanecarboxylate |
| SMILES | CC(C)COCCOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C13H24O3/c1-11(2)10-15-8-9-16-13(14)12-6-4-3-5-7-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | AYHDDQKSVBDHTE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylpropoxy)ethyl cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropoxy)ethyl cyclohexanecarboxylate?
The IUPAC name of 2-(2-methylpropoxy)ethyl cyclohexanecarboxylate (CID 59197441) is 2-(2-methylpropoxy)ethyl cyclohexanecarboxylate.
What is the SMILES notation for 2-(2-methylpropoxy)ethyl cyclohexanecarboxylate?
The canonical SMILES for 2-(2-methylpropoxy)ethyl cyclohexanecarboxylate is CC(C)COCCOC(=O)C1CCCCC1.
What is the InChIKey of 2-(2-methylpropoxy)ethyl cyclohexanecarboxylate?
The InChIKey is AYHDDQKSVBDHTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-11(2)10-15-8-9-16-13(14)12-6-4-3-5-7-12/h11-12H,3-10H2,1-2H3.
What are the key properties of 2-(2-methylpropoxy)ethyl cyclohexanecarboxylate?
2-(2-methylpropoxy)ethyl cyclohexanecarboxylate has a molecular weight of 228.33 g/mol, XLogP of 2.78, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropoxy)ethyl cyclohexanecarboxylate is sourced from PubChem (CID 59197441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).