C39H58O9 — CID 59197519
1-O-(3-hydroxy-1-adamantyl) 3-O-(2-methyl-2-adamantyl) 5-O-(2-oxooxolan-3-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 59197519) has the molecular formula C39H58O9 and a molecular weight of 670.88 g/mol. Its IUPAC name is 1-O-(3-hydroxy-1-adamantyl) 3-O-(2-methyl-2-adamantyl) 5-O-(2-oxooxolan-3-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-(3-hydroxy-1-adamantyl) 3-O-(2-methyl-2-adamantyl) 5-O-(2-oxooxolan-3-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 59197519 |
| Molecular Formula | C39H58O9 |
| Molecular Weight | 670.88 g/mol |
| Exact Mass | 670.41 |
| IUPAC Name | 1-O-(3-hydroxy-1-adamantyl) 3-O-(2-methyl-2-adamantyl) 5-O-(2-oxooxolan-3-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OC12CC3CC(CC(O)(C3)C1)C2)C(=O)OC1(C)C2CC3CC(C2)CC1C3)C(=O)OC1CCOC1=O |
| InChI | InChI=1S/C39H58O9/c1-7-35(4,32(42)46-29-8-9-45-30(29)40)21-36(5,33(43)47-37(6)27-12-23-10-24(14-27)15-28(37)13-23)20-34(2,3)31(41)48-39-18-25-11-26(19-39)17-38(44,16-25)22-39/h23-29,44H,7-22H2,1-6H3 |
| InChIKey | ODLFRXPPBCRNBB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.88 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|