About 1-amino-[1]benzothiolo[2,3-d]pyridazine-4-carboxamide
1-amino-[1]benzothiolo[2,3-d]pyridazine-4-carboxamide (PubChem CID 59198478) has the molecular formula C11H8N4OS
and a molecular weight of 244.28 g/mol. Its IUPAC name is 1-amino-[1]benzothiolo[2,3-d]pyridazine-4-carboxamide.
Molecular Properties
| Compound Name | 1-amino-[1]benzothiolo[2,3-d]pyridazine-4-carboxamide |
| PubChem CID | 59198478 |
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 1-amino-[1]benzothiolo[2,3-d]pyridazine-4-carboxamide |
| SMILES | NC(=O)c1nnc(N)c2c1sc1ccccc12 |
| InChI | InChI=1S/C11H8N4OS/c12-10-7-5-3-1-2-4-6(5)17-9(7)8(11(13)16)14-15-10/h1-4H,(H2,12,15)(H2,13,16) |
| InChIKey | PPOLQUQCOLRNOK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-amino-[1]benzothiolo[2,3-d]pyridazine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-[1]benzothiolo[2,3-d]pyridazine-4-carboxamide?
The IUPAC name of 1-amino-[1]benzothiolo[2,3-d]pyridazine-4-carboxamide (CID 59198478) is 1-amino-[1]benzothiolo[2,3-d]pyridazine-4-carboxamide.
What is the SMILES notation for 1-amino-[1]benzothiolo[2,3-d]pyridazine-4-carboxamide?
The canonical SMILES for 1-amino-[1]benzothiolo[2,3-d]pyridazine-4-carboxamide is NC(=O)c1nnc(N)c2c1sc1ccccc12.
What is the InChIKey of 1-amino-[1]benzothiolo[2,3-d]pyridazine-4-carboxamide?
The InChIKey is PPOLQUQCOLRNOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4OS/c12-10-7-5-3-1-2-4-6(5)17-9(7)8(11(13)16)14-15-10/h1-4H,(H2,12,15)(H2,13,16).
What are the key properties of 1-amino-[1]benzothiolo[2,3-d]pyridazine-4-carboxamide?
1-amino-[1]benzothiolo[2,3-d]pyridazine-4-carboxamide has a molecular weight of 244.28 g/mol, XLogP of 1.53, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-[1]benzothiolo[2,3-d]pyridazine-4-carboxamide is sourced from PubChem (CID 59198478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).