About 1-cyclohexyl-7-(3,5-dimethylpyrazol-1-yl)-5H-imidazo[1,5-a]quinoxalin-4-one
1-cyclohexyl-7-(3,5-dimethylpyrazol-1-yl)-5H-imidazo[1,5-a]quinoxalin-4-one (PubChem CID 59198759) has the molecular formula C21H23N5O
and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-cyclohexyl-7-(3,5-dimethylpyrazol-1-yl)-5H-imidazo[1,5-a]quinoxalin-4-one.
Molecular Properties
| Compound Name | 1-cyclohexyl-7-(3,5-dimethylpyrazol-1-yl)-5H-imidazo[1,5-a]quinoxalin-4-one |
| PubChem CID | 59198759 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 1-cyclohexyl-7-(3,5-dimethylpyrazol-1-yl)-5H-imidazo[1,5-a]quinoxalin-4-one |
| SMILES | Cc1cc(C)n(-c2ccc3c(c2)[nH]c(=O)c2cnc(C4CCCCC4)n23)n1 |
| InChI | InChI=1S/C21H23N5O/c1-13-10-14(2)26(24-13)16-8-9-18-17(11-16)23-21(27)19-12-22-20(25(18)19)15-6-4-3-5-7-15/h8-12,15H,3-7H2,1-2H3,(H,23,27) |
| InChIKey | KBTXNDHQNLHSTE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyclohexyl-7-(3,5-dimethylpyrazol-1-yl)-5H-imidazo[1,5-a]quinoxalin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-7-(3,5-dimethylpyrazol-1-yl)-5H-imidazo[1,5-a]quinoxalin-4-one?
The IUPAC name of 1-cyclohexyl-7-(3,5-dimethylpyrazol-1-yl)-5H-imidazo[1,5-a]quinoxalin-4-one (CID 59198759) is 1-cyclohexyl-7-(3,5-dimethylpyrazol-1-yl)-5H-imidazo[1,5-a]quinoxalin-4-one.
What is the SMILES notation for 1-cyclohexyl-7-(3,5-dimethylpyrazol-1-yl)-5H-imidazo[1,5-a]quinoxalin-4-one?
The canonical SMILES for 1-cyclohexyl-7-(3,5-dimethylpyrazol-1-yl)-5H-imidazo[1,5-a]quinoxalin-4-one is Cc1cc(C)n(-c2ccc3c(c2)[nH]c(=O)c2cnc(C4CCCCC4)n23)n1.
What is the InChIKey of 1-cyclohexyl-7-(3,5-dimethylpyrazol-1-yl)-5H-imidazo[1,5-a]quinoxalin-4-one?
The InChIKey is KBTXNDHQNLHSTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N5O/c1-13-10-14(2)26(24-13)16-8-9-18-17(11-16)23-21(27)19-12-22-20(25(18)19)15-6-4-3-5-7-15/h8-12,15H,3-7H2,1-2H3,(H,23,27).
What are the key properties of 1-cyclohexyl-7-(3,5-dimethylpyrazol-1-yl)-5H-imidazo[1,5-a]quinoxalin-4-one?
1-cyclohexyl-7-(3,5-dimethylpyrazol-1-yl)-5H-imidazo[1,5-a]quinoxalin-4-one has a molecular weight of 361.45 g/mol, XLogP of 4.03, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-7-(3,5-dimethylpyrazol-1-yl)-5H-imidazo[1,5-a]quinoxalin-4-one is sourced from PubChem (CID 59198759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).