About (3R)-3-amino-2,5,5-trimethylhexan-2-ol
(3R)-3-amino-2,5,5-trimethylhexan-2-ol (PubChem CID 59199538) has the molecular formula C9H21NO
and a molecular weight of 159.27 g/mol. Its IUPAC name is (3R)-3-amino-2,5,5-trimethylhexan-2-ol.
Molecular Properties
| Compound Name | (3R)-3-amino-2,5,5-trimethylhexan-2-ol |
| PubChem CID | 59199538 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | (3R)-3-amino-2,5,5-trimethylhexan-2-ol |
| SMILES | CC(C)(C)C[C@H](C(C)(C)O)N |
| InChI | InChI=1S/C9H21NO/c1-8(2,3)6-7(10)9(4,5)11/h7,11H,6,10H2,1-5H3/t7-/m1/s1 |
| InChIKey | KKDUOWQVUQHEDQ-SSDOTTSWSA-N |
| XLogP | 1.40 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | 124 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-amino-2,5,5-trimethylhexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-2,5,5-trimethylhexan-2-ol?
The IUPAC name of (3R)-3-amino-2,5,5-trimethylhexan-2-ol (CID 59199538) is (3R)-3-amino-2,5,5-trimethylhexan-2-ol.
What is the SMILES notation for (3R)-3-amino-2,5,5-trimethylhexan-2-ol?
The canonical SMILES for (3R)-3-amino-2,5,5-trimethylhexan-2-ol is CC(C)(C)C[C@H](C(C)(C)O)N.
What is the InChIKey of (3R)-3-amino-2,5,5-trimethylhexan-2-ol?
The InChIKey is KKDUOWQVUQHEDQ-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H21NO/c1-8(2,3)6-7(10)9(4,5)11/h7,11H,6,10H2,1-5H3/t7-/m1/s1.
What are the key properties of (3R)-3-amino-2,5,5-trimethylhexan-2-ol?
(3R)-3-amino-2,5,5-trimethylhexan-2-ol has a molecular weight of 159.27 g/mol, XLogP of 1.40, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-2,5,5-trimethylhexan-2-ol is sourced from PubChem (CID 59199538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).