C8H10N2O3 — CID 59199891
5-butanoyl-1H-pyrimidine-2,4-dione (PubChem CID 59199891) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 5-butanoyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-butanoyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59199891 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 5-butanoyl-1H-pyrimidine-2,4-dione |
| SMILES | CCCC(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H10N2O3/c1-2-3-6(11)5-4-9-8(13)10-7(5)12/h4H,2-3H2,1H3,(H2,9,10,12,13) |
| InChIKey | CNZVDQTYSWYAJR-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |