About (2R)-2-cyclopenta-1,3-dien-1-yl-2-(methylamino)ethanethiol
(2R)-2-cyclopenta-1,3-dien-1-yl-2-(methylamino)ethanethiol (PubChem CID 59200555) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is (2R)-2-cyclopenta-1,3-dien-1-yl-2-(methylamino)ethanethiol.
Molecular Properties
| Compound Name | (2R)-2-cyclopenta-1,3-dien-1-yl-2-(methylamino)ethanethiol |
| PubChem CID | 59200555 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | (2R)-2-cyclopenta-1,3-dien-1-yl-2-(methylamino)ethanethiol |
| SMILES | CN[C@@H](CS)C1=CC=CC1 |
| InChI | InChI=1S/C8H13NS/c1-9-8(6-10)7-4-2-3-5-7/h2-4,8-10H,5-6H2,1H3/t8-/m0/s1 |
| InChIKey | AMYNUXAGUQAOKD-QMMMGPOBSA-N |
| XLogP | 1.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-cyclopenta-1,3-dien-1-yl-2-(methylamino)ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-cyclopenta-1,3-dien-1-yl-2-(methylamino)ethanethiol?
The IUPAC name of (2R)-2-cyclopenta-1,3-dien-1-yl-2-(methylamino)ethanethiol (CID 59200555) is (2R)-2-cyclopenta-1,3-dien-1-yl-2-(methylamino)ethanethiol.
What is the SMILES notation for (2R)-2-cyclopenta-1,3-dien-1-yl-2-(methylamino)ethanethiol?
The canonical SMILES for (2R)-2-cyclopenta-1,3-dien-1-yl-2-(methylamino)ethanethiol is CN[C@@H](CS)C1=CC=CC1.
What is the InChIKey of (2R)-2-cyclopenta-1,3-dien-1-yl-2-(methylamino)ethanethiol?
The InChIKey is AMYNUXAGUQAOKD-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H13NS/c1-9-8(6-10)7-4-2-3-5-7/h2-4,8-10H,5-6H2,1H3/t8-/m0/s1.
What are the key properties of (2R)-2-cyclopenta-1,3-dien-1-yl-2-(methylamino)ethanethiol?
(2R)-2-cyclopenta-1,3-dien-1-yl-2-(methylamino)ethanethiol has a molecular weight of 155.27 g/mol, XLogP of 1.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-cyclopenta-1,3-dien-1-yl-2-(methylamino)ethanethiol is sourced from PubChem (CID 59200555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).