C20H21ClN6 — CID 59200661
9-N-(3-aminopropyl)-2-N-(3-chlorophenyl)-5,6-dihydropyrido[3,4-h]quinazoline-2,9-diamine (PubChem CID 59200661) has the molecular formula C20H21ClN6 and a molecular weight of 380.88 g/mol. Its IUPAC name is 9-N-(3-aminopropyl)-2-N-(3-chlorophenyl)-5,6-dihydropyrido[3,4-h]quinazoline-2,9-diamine.
| Compound Name | 9-N-(3-aminopropyl)-2-N-(3-chlorophenyl)-5,6-dihydropyrido[3,4-h]quinazoline-2,9-diamine |
|---|---|
| PubChem CID | 59200661 |
| Molecular Formula | C20H21ClN6 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 9-N-(3-aminopropyl)-2-N-(3-chlorophenyl)-5,6-dihydropyrido[3,4-h]quinazoline-2,9-diamine |
| SMILES | NCCCNc1cc2c(cn1)CCc1cnc(Nc3cccc(Cl)c3)nc1-2 |
| InChI | InChI=1S/C20H21ClN6/c21-15-3-1-4-16(9-15)26-20-25-12-14-6-5-13-11-24-18(23-8-2-7-22)10-17(13)19(14)27-20/h1,3-4,9-12H,2,5-8,22H2,(H,23,24)(H,25,26,27) |
| InChIKey | MQABUYNOMUOFLK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|