About trans-(1R,2R)-5,5-diethyl-2-pyrrolidin-1-ylcyclohexan-1-ol
trans-(1R,2R)-5,5-diethyl-2-pyrrolidin-1-ylcyclohexan-1-ol (PubChem CID 59200793) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is trans-(1R,2R)-5,5-diethyl-2-pyrrolidin-1-ylcyclohexan-1-ol.
Molecular Properties
| Compound Name | trans-(1R,2R)-5,5-diethyl-2-pyrrolidin-1-ylcyclohexan-1-ol |
| PubChem CID | 59200793 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | trans-(1R,2R)-5,5-diethyl-2-pyrrolidin-1-ylcyclohexan-1-ol |
| SMILES | CCC1(CC)CC[C@@H](N2CCCC2)[C@H](O)C1 |
| InChI | InChI=1S/C14H27NO/c1-3-14(4-2)8-7-12(13(16)11-14)15-9-5-6-10-15/h12-13,16H,3-11H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | RKWVJEKSEHNIFO-CHWSQXEVSA-N |
| XLogP | 2.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1R,2R)-5,5-diethyl-2-pyrrolidin-1-ylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-5,5-diethyl-2-pyrrolidin-1-ylcyclohexan-1-ol?
The IUPAC name of trans-(1R,2R)-5,5-diethyl-2-pyrrolidin-1-ylcyclohexan-1-ol (CID 59200793) is trans-(1R,2R)-5,5-diethyl-2-pyrrolidin-1-ylcyclohexan-1-ol.
What is the SMILES notation for trans-(1R,2R)-5,5-diethyl-2-pyrrolidin-1-ylcyclohexan-1-ol?
The canonical SMILES for trans-(1R,2R)-5,5-diethyl-2-pyrrolidin-1-ylcyclohexan-1-ol is CCC1(CC)CC[C@@H](N2CCCC2)[C@H](O)C1.
What is the InChIKey of trans-(1R,2R)-5,5-diethyl-2-pyrrolidin-1-ylcyclohexan-1-ol?
The InChIKey is RKWVJEKSEHNIFO-CHWSQXEVSA-N. The full InChI is InChI=1S/C14H27NO/c1-3-14(4-2)8-7-12(13(16)11-14)15-9-5-6-10-15/h12-13,16H,3-11H2,1-2H3/t12-,13-/m1/s1.
What are the key properties of trans-(1R,2R)-5,5-diethyl-2-pyrrolidin-1-ylcyclohexan-1-ol?
trans-(1R,2R)-5,5-diethyl-2-pyrrolidin-1-ylcyclohexan-1-ol has a molecular weight of 225.38 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-5,5-diethyl-2-pyrrolidin-1-ylcyclohexan-1-ol is sourced from PubChem (CID 59200793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).