C19H19NO3 — CID 59200840
6-[(E)-3-oxobut-1-enyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one (PubChem CID 59200840) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 6-[(E)-3-oxobut-1-enyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one.
| Compound Name | 6-[(E)-3-oxobut-1-enyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
|---|---|
| PubChem CID | 59200840 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 6-[(E)-3-oxobut-1-enyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
| SMILES | CC(=O)/C=C/c1cc(=O)oc2c3c4c(cc12)CCCN4CCC3 |
| InChI | InChI=1S/C19H19NO3/c1-12(21)6-7-13-11-17(22)23-19-15-5-3-9-20-8-2-4-14(18(15)20)10-16(13)19/h6-7,10-11H,2-5,8-9H2,1H3/b7-6+ |
| InChIKey | CIZFUMDVSBIICA-VOTSOKGWSA-N |
| XLogP | 3.09 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|