C30H27F6N3O5 — CID 59200902
5-(2,3-dihydro-1-benzofuran-5-yl)-3-[[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-4-pyridinyl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 59200902) has the molecular formula C30H27F6N3O5 and a molecular weight of 623.55 g/mol. Its IUPAC name is 5-(2,3-dihydro-1-benzofuran-5-yl)-3-[[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-4-pyridinyl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2,3-dihydro-1-benzofuran-5-yl)-3-[[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-4-pyridinyl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59200902 |
| Molecular Formula | C30H27F6N3O5 |
| Molecular Weight | 623.55 g/mol |
| Exact Mass | 623.19 |
| IUPAC Name | 5-(2,3-dihydro-1-benzofuran-5-yl)-3-[[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-4-pyridinyl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1cc(CN2C(=O)NC(C)(c3ccc4c(c3)CCO4)C2=O)ccn1 |
| InChI | InChI=1S/C30H27F6N3O5/c1-3-4-18-15-21(28(42,29(31,32)33)30(34,35)36)6-8-23(18)44-24-13-17(9-11-37-24)16-39-25(40)27(2,38-26(39)41)20-5-7-22-19(14-20)10-12-43-22/h5-9,11,13-15,42H,3-4,10,12,16H2,1-2H3,(H,38,41) |
| InChIKey | XNAZLPIGQPSMHM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|