C24H25F6N3O4 — CID 59200903
3-[[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-4-pyridinyl]methyl]-1,5,5-trimethylimidazolidine-2,4-dione (PubChem CID 59200903) has the molecular formula C24H25F6N3O4 and a molecular weight of 533.47 g/mol. Its IUPAC name is 3-[[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-4-pyridinyl]methyl]-1,5,5-trimethylimidazolidine-2,4-dione.
| Compound Name | 3-[[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-4-pyridinyl]methyl]-1,5,5-trimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59200903 |
| Molecular Formula | C24H25F6N3O4 |
| Molecular Weight | 533.47 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 3-[[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-4-pyridinyl]methyl]-1,5,5-trimethylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1cc(CN2C(=O)N(C)C(C)(C)C2=O)ccn1 |
| InChI | InChI=1S/C24H25F6N3O4/c1-5-6-15-12-16(22(36,23(25,26)27)24(28,29)30)7-8-17(15)37-18-11-14(9-10-31-18)13-33-19(34)21(2,3)32(4)20(33)35/h7-12,36H,5-6,13H2,1-4H3 |
| InChIKey | HUFQSHMTZQCRCZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|