C32H27F6N3O4 — CID 59200909
3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione (PubChem CID 59200909) has the molecular formula C32H27F6N3O4 and a molecular weight of 631.57 g/mol. Its IUPAC name is 3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione.
| Compound Name | 3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59200909 |
| Molecular Formula | C32H27F6N3O4 |
| Molecular Weight | 631.57 g/mol |
| Exact Mass | 631.19 |
| IUPAC Name | 3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1ccnc(CN2C(=O)NC(C)(c3ccc4ccccc4c3)C2=O)c1 |
| InChI | InChI=1S/C32H27F6N3O4/c1-3-6-21-16-23(30(44,31(33,34)35)32(36,37)38)11-12-26(21)45-25-13-14-39-24(17-25)18-41-27(42)29(2,40-28(41)43)22-10-9-19-7-4-5-8-20(19)15-22/h4-5,7-17,44H,3,6,18H2,1-2H3,(H,40,43) |
| InChIKey | JGWZOBVPQBODIU-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.57 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|