C32H33F6N3O4 — CID 59200911
5-(4-tert-butylphenyl)-3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 59200911) has the molecular formula C32H33F6N3O4 and a molecular weight of 637.62 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(4-tert-butylphenyl)-3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59200911 |
| Molecular Formula | C32H33F6N3O4 |
| Molecular Weight | 637.62 g/mol |
| Exact Mass | 637.24 |
| IUPAC Name | 5-(4-tert-butylphenyl)-3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1ccnc(CN2C(=O)NC(C)(c3ccc(C(C)(C)C)cc3)C2=O)c1 |
| InChI | InChI=1S/C32H33F6N3O4/c1-6-7-19-16-22(30(44,31(33,34)35)32(36,37)38)12-13-25(19)45-24-14-15-39-23(17-24)18-41-26(42)29(5,40-27(41)43)21-10-8-20(9-11-21)28(2,3)4/h8-17,44H,6-7,18H2,1-5H3,(H,40,43) |
| InChIKey | BGZYUDXGAAKONI-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.62 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|