C27H24F6N4O4 — CID 59200917
3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methyl-5-pyridin-4-ylimidazolidine-2,4-dione (PubChem CID 59200917) has the molecular formula C27H24F6N4O4 and a molecular weight of 582.50 g/mol. Its IUPAC name is 3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methyl-5-pyridin-4-ylimidazolidine-2,4-dione.
| Compound Name | 3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methyl-5-pyridin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59200917 |
| Molecular Formula | C27H24F6N4O4 |
| Molecular Weight | 582.50 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | 3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methyl-5-pyridin-4-ylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1ccnc(CN2C(=O)NC(C)(c3ccncc3)C2=O)c1 |
| InChI | InChI=1S/C27H24F6N4O4/c1-3-4-16-13-18(25(40,26(28,29)30)27(31,32)33)5-6-21(16)41-20-9-12-35-19(14-20)15-37-22(38)24(2,36-23(37)39)17-7-10-34-11-8-17/h5-14,40H,3-4,15H2,1-2H3,(H,36,39) |
| InChIKey | QKDCUPJOJIXBCO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|