C34H36F6N2O5 — CID 59200977
3-[2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-methylphenyl]ethyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione (PubChem CID 59200977) has the molecular formula C34H36F6N2O5 and a molecular weight of 666.66 g/mol. Its IUPAC name is 3-[2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-methylphenyl]ethyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-methylphenyl]ethyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59200977 |
| Molecular Formula | C34H36F6N2O5 |
| Molecular Weight | 666.66 g/mol |
| Exact Mass | 666.25 |
| IUPAC Name | 3-[2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-methylphenyl]ethyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1ccc(CCN2C(=O)NC(C)(c3ccc(OC(C)C)cc3)C2=O)c(C)c1 |
| InChI | InChI=1S/C34H36F6N2O5/c1-6-7-23-19-25(32(45,33(35,36)37)34(38,39)40)11-15-28(23)47-27-12-8-22(21(4)18-27)16-17-42-29(43)31(5,41-30(42)44)24-9-13-26(14-10-24)46-20(2)3/h8-15,18-20,45H,6-7,16-17H2,1-5H3,(H,41,44) |
| InChIKey | JDMOAMFFFMHAGP-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.66 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|