C29H27F6N3O5 — CID 59201023
3-[[6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-(2-methoxyphenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 59201023) has the molecular formula C29H27F6N3O5 and a molecular weight of 611.54 g/mol. Its IUPAC name is 3-[[6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-(2-methoxyphenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[[6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-(2-methoxyphenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59201023 |
| Molecular Formula | C29H27F6N3O5 |
| Molecular Weight | 611.54 g/mol |
| Exact Mass | 611.19 |
| IUPAC Name | 3-[[6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-(2-methoxyphenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1cccc(CN2C(=O)NC(C)(c3ccccc3OC)C2=O)n1 |
| InChI | InChI=1S/C29H27F6N3O5/c1-4-8-17-15-18(27(41,28(30,31)32)29(33,34)35)13-14-21(17)43-23-12-7-9-19(36-23)16-38-24(39)26(2,37-25(38)40)20-10-5-6-11-22(20)42-3/h5-7,9-15,41H,4,8,16H2,1-3H3,(H,37,40) |
| InChIKey | QBIWPBXUXKRJPJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|