C25H26F6N2O4 — CID 59201032
3-[[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]methyl]-1,5,5-trimethylimidazolidine-2,4-dione (PubChem CID 59201032) has the molecular formula C25H26F6N2O4 and a molecular weight of 532.48 g/mol. Its IUPAC name is 3-[[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]methyl]-1,5,5-trimethylimidazolidine-2,4-dione.
| Compound Name | 3-[[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]methyl]-1,5,5-trimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59201032 |
| Molecular Formula | C25H26F6N2O4 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 3-[[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]methyl]-1,5,5-trimethylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1cccc(CN2C(=O)N(C)C(C)(C)C2=O)c1 |
| InChI | InChI=1S/C25H26F6N2O4/c1-5-7-16-13-17(23(36,24(26,27)28)25(29,30)31)10-11-19(16)37-18-9-6-8-15(12-18)14-33-20(34)22(2,3)32(4)21(33)35/h6,8-13,36H,5,7,14H2,1-4H3 |
| InChIKey | VEHBMINZXAOPJO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|