C20H21F6NO4 — CID 59201054
[4-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenoxy]-2-pyridinyl]methanol (PubChem CID 59201054) has the molecular formula C20H21F6NO4 and a molecular weight of 453.38 g/mol. Its IUPAC name is [4-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenoxy]-2-pyridinyl]methanol.
| Compound Name | [4-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenoxy]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 59201054 |
| Molecular Formula | C20H21F6NO4 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | [4-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenoxy]-2-pyridinyl]methanol |
| SMILES | CCCc1cc(C(OCOC)(C(F)(F)F)C(F)(F)F)ccc1Oc1ccnc(CO)c1 |
| InChI | InChI=1S/C20H21F6NO4/c1-3-4-13-9-14(18(19(21,22)23,20(24,25)26)30-12-29-2)5-6-17(13)31-16-7-8-27-15(10-16)11-28/h5-10,28H,3-4,11-12H2,1-2H3 |
| InChIKey | ACOOGYQENHXNMO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|