C33H32F6N2O7 — CID 59201087
3-[2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-hydroxyphenyl]-2-oxoethyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione (PubChem CID 59201087) has the molecular formula C33H32F6N2O7 and a molecular weight of 682.61 g/mol. Its IUPAC name is 3-[2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-hydroxyphenyl]-2-oxoethyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-hydroxyphenyl]-2-oxoethyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59201087 |
| Molecular Formula | C33H32F6N2O7 |
| Molecular Weight | 682.61 g/mol |
| Exact Mass | 682.21 |
| IUPAC Name | 3-[2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-hydroxyphenyl]-2-oxoethyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1ccc(C(=O)CN2C(=O)NC(C)(c3ccc(OC(C)C)cc3)C2=O)c(O)c1 |
| InChI | InChI=1S/C33H32F6N2O7/c1-5-6-19-15-21(31(46,32(34,35)36)33(37,38)39)9-14-27(19)48-23-12-13-24(25(42)16-23)26(43)17-41-28(44)30(4,40-29(41)45)20-7-10-22(11-8-20)47-18(2)3/h7-16,18,42,46H,5-6,17H2,1-4H3,(H,40,45) |
| InChIKey | CINWDGRLSZBYBJ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.61 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|