C33H32F6N2O6 — CID 59201131
3-[2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]-2-oxoethyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione (PubChem CID 59201131) has the molecular formula C33H32F6N2O6 and a molecular weight of 666.62 g/mol. Its IUPAC name is 3-[2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]-2-oxoethyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]-2-oxoethyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59201131 |
| Molecular Formula | C33H32F6N2O6 |
| Molecular Weight | 666.62 g/mol |
| Exact Mass | 666.22 |
| IUPAC Name | 3-[2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]-2-oxoethyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1ccc(C(=O)CN2C(=O)NC(C)(c3ccc(OC(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C33H32F6N2O6/c1-5-6-21-17-23(31(45,32(34,35)36)33(37,38)39)11-16-27(21)47-25-12-7-20(8-13-25)26(42)18-41-28(43)30(4,40-29(41)44)22-9-14-24(15-10-22)46-19(2)3/h7-17,19,45H,5-6,18H2,1-4H3,(H,40,44) |
| InChIKey | HITJSXNGOCIANZ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|