C21H30ClFN2O5 — CID 59201486
tert-butyl (3R)-3-[(R)-(3-chloro-5-fluorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carboxylate (PubChem CID 59201486) has the molecular formula C21H30ClFN2O5 and a molecular weight of 444.93 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(R)-(3-chloro-5-fluorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(R)-(3-chloro-5-fluorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59201486 |
| Molecular Formula | C21H30ClFN2O5 |
| Molecular Weight | 444.93 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | tert-butyl (3R)-3-[(R)-(3-chloro-5-fluorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carboxylate |
| SMILES | COC(=O)NCCO[C@@H](c1cc(F)cc(Cl)c1)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H30ClFN2O5/c1-21(2,3)30-20(27)25-8-5-6-14(13-25)18(29-9-7-24-19(26)28-4)15-10-16(22)12-17(23)11-15/h10-12,14,18H,5-9,13H2,1-4H3,(H,24,26)/t14-,18-/m1/s1 |
| InChIKey | XKAHDQADTVHISS-RDTXWAMCSA-N |
| XLogP | 4.54 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.93 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|