C21H21N3O3 — CID 59202005
2-[(2R,3S)-1-oxo-3-pyridin-4-yl-1-pyrrolidin-1-ylbutan-2-yl]isoindole-1,3-dione (PubChem CID 59202005) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-[(2R,3S)-1-oxo-3-pyridin-4-yl-1-pyrrolidin-1-ylbutan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,3S)-1-oxo-3-pyridin-4-yl-1-pyrrolidin-1-ylbutan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59202005 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-[(2R,3S)-1-oxo-3-pyridin-4-yl-1-pyrrolidin-1-ylbutan-2-yl]isoindole-1,3-dione |
| SMILES | C[C@@H](c1ccncc1)[C@H](C(=O)N1CCCC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H21N3O3/c1-14(15-8-10-22-11-9-15)18(21(27)23-12-4-5-13-23)24-19(25)16-6-2-3-7-17(16)20(24)26/h2-3,6-11,14,18H,4-5,12-13H2,1H3/t14-,18+/m0/s1 |
| InChIKey | BUGSUIQOJRCNIB-KBXCAEBGSA-N |
| XLogP | 2.47 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|