About N-[(5-chloro-2-pyridinyl)methyl]-N'-cyano-N-(3,3-difluoroprop-2-enyl)ethanimidamide
N-[(5-chloro-2-pyridinyl)methyl]-N'-cyano-N-(3,3-difluoroprop-2-enyl)ethanimidamide (PubChem CID 59202008) has the molecular formula C12H11ClF2N4
and a molecular weight of 284.70 g/mol. Its IUPAC name is N-[(5-chloro-2-pyridinyl)methyl]-N'-cyano-N-(3,3-difluoroprop-2-enyl)ethanimidamide.
Molecular Properties
| Compound Name | N-[(5-chloro-2-pyridinyl)methyl]-N'-cyano-N-(3,3-difluoroprop-2-enyl)ethanimidamide |
| PubChem CID | 59202008 |
| Molecular Formula | C12H11ClF2N4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | N-[(5-chloro-2-pyridinyl)methyl]-N'-cyano-N-(3,3-difluoroprop-2-enyl)ethanimidamide |
| SMILES | C/C(=N\C#N)N(CC=C(F)F)Cc1ccc(Cl)cn1 |
| InChI | InChI=1S/C12H11ClF2N4/c1-9(18-8-16)19(5-4-12(14)15)7-11-3-2-10(13)6-17-11/h2-4,6H,5,7H2,1H3/b18-9+ |
| InChIKey | IVOAIQXCEKMMLA-GIJQJNRQSA-N |
| XLogP | 3.22 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-chloro-2-pyridinyl)methyl]-N'-cyano-N-(3,3-difluoroprop-2-enyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-chloro-2-pyridinyl)methyl]-N'-cyano-N-(3,3-difluoroprop-2-enyl)ethanimidamide?
The IUPAC name of N-[(5-chloro-2-pyridinyl)methyl]-N'-cyano-N-(3,3-difluoroprop-2-enyl)ethanimidamide (CID 59202008) is N-[(5-chloro-2-pyridinyl)methyl]-N'-cyano-N-(3,3-difluoroprop-2-enyl)ethanimidamide.
What is the SMILES notation for N-[(5-chloro-2-pyridinyl)methyl]-N'-cyano-N-(3,3-difluoroprop-2-enyl)ethanimidamide?
The canonical SMILES for N-[(5-chloro-2-pyridinyl)methyl]-N'-cyano-N-(3,3-difluoroprop-2-enyl)ethanimidamide is C/C(=N\C#N)N(CC=C(F)F)Cc1ccc(Cl)cn1.
What is the InChIKey of N-[(5-chloro-2-pyridinyl)methyl]-N'-cyano-N-(3,3-difluoroprop-2-enyl)ethanimidamide?
The InChIKey is IVOAIQXCEKMMLA-GIJQJNRQSA-N. The full InChI is InChI=1S/C12H11ClF2N4/c1-9(18-8-16)19(5-4-12(14)15)7-11-3-2-10(13)6-17-11/h2-4,6H,5,7H2,1H3/b18-9+.
What are the key properties of N-[(5-chloro-2-pyridinyl)methyl]-N'-cyano-N-(3,3-difluoroprop-2-enyl)ethanimidamide?
N-[(5-chloro-2-pyridinyl)methyl]-N'-cyano-N-(3,3-difluoroprop-2-enyl)ethanimidamide has a molecular weight of 284.70 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-chloro-2-pyridinyl)methyl]-N'-cyano-N-(3,3-difluoroprop-2-enyl)ethanimidamide is sourced from PubChem (CID 59202008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).