About 2-(3-methylbutylsulfanyl)-3-propan-2-yl-2,3-dihydrofuran
2-(3-methylbutylsulfanyl)-3-propan-2-yl-2,3-dihydrofuran (PubChem CID 59202145) has the molecular formula C12H22OS
and a molecular weight of 214.37 g/mol. Its IUPAC name is 2-(3-methylbutylsulfanyl)-3-propan-2-yl-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 2-(3-methylbutylsulfanyl)-3-propan-2-yl-2,3-dihydrofuran |
| PubChem CID | 59202145 |
| Molecular Formula | C12H22OS |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2-(3-methylbutylsulfanyl)-3-propan-2-yl-2,3-dihydrofuran |
| SMILES | CC(C)CCSC1OC=CC1C(C)C |
| InChI | InChI=1S/C12H22OS/c1-9(2)6-8-14-12-11(10(3)4)5-7-13-12/h5,7,9-12H,6,8H2,1-4H3 |
| InChIKey | KXYHEGSFJQHHIO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-methylbutylsulfanyl)-3-propan-2-yl-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylbutylsulfanyl)-3-propan-2-yl-2,3-dihydrofuran?
The IUPAC name of 2-(3-methylbutylsulfanyl)-3-propan-2-yl-2,3-dihydrofuran (CID 59202145) is 2-(3-methylbutylsulfanyl)-3-propan-2-yl-2,3-dihydrofuran.
What is the SMILES notation for 2-(3-methylbutylsulfanyl)-3-propan-2-yl-2,3-dihydrofuran?
The canonical SMILES for 2-(3-methylbutylsulfanyl)-3-propan-2-yl-2,3-dihydrofuran is CC(C)CCSC1OC=CC1C(C)C.
What is the InChIKey of 2-(3-methylbutylsulfanyl)-3-propan-2-yl-2,3-dihydrofuran?
The InChIKey is KXYHEGSFJQHHIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22OS/c1-9(2)6-8-14-12-11(10(3)4)5-7-13-12/h5,7,9-12H,6,8H2,1-4H3.
What are the key properties of 2-(3-methylbutylsulfanyl)-3-propan-2-yl-2,3-dihydrofuran?
2-(3-methylbutylsulfanyl)-3-propan-2-yl-2,3-dihydrofuran has a molecular weight of 214.37 g/mol, XLogP of 3.91, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylbutylsulfanyl)-3-propan-2-yl-2,3-dihydrofuran is sourced from PubChem (CID 59202145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).