C22H45IO2Si2 — CID 59202256
tert-butyl-[(3S,4S,5E,7Z)-3-[tert-butyl(dimethyl)silyl]oxy-8-iodo-4,6-dimethylocta-5,7-dienoxy]-dimethylsilane (PubChem CID 59202256) has the molecular formula C22H45IO2Si2 and a molecular weight of 524.68 g/mol. Its IUPAC name is tert-butyl-[(3S,4S,5E,7Z)-3-[tert-butyl(dimethyl)silyl]oxy-8-iodo-4,6-dimethylocta-5,7-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4S,5E,7Z)-3-[tert-butyl(dimethyl)silyl]oxy-8-iodo-4,6-dimethylocta-5,7-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 59202256 |
| Molecular Formula | C22H45IO2Si2 |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | tert-butyl-[(3S,4S,5E,7Z)-3-[tert-butyl(dimethyl)silyl]oxy-8-iodo-4,6-dimethylocta-5,7-dienoxy]-dimethylsilane |
| SMILES | CC(/C=C\I)=C\[C@H](C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H45IO2Si2/c1-18(13-15-23)17-19(2)20(25-27(11,12)22(6,7)8)14-16-24-26(9,10)21(3,4)5/h13,15,17,19-20H,14,16H2,1-12H3/b15-13-,18-17+/t19-,20-/m0/s1 |
| InChIKey | OMXOQMMIPUEFBI-PJJPUHDZSA-N |
| XLogP | 8.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|