C13H17IO3 — CID 59202258
(2S)-2-[(2S,3E,5Z)-6-iodo-4-methylhexa-3,5-dien-2-yl]-5-methoxy-2,3-dihydropyran-6-one (PubChem CID 59202258) has the molecular formula C13H17IO3 and a molecular weight of 348.18 g/mol. Its IUPAC name is (2S)-2-[(2S,3E,5Z)-6-iodo-4-methylhexa-3,5-dien-2-yl]-5-methoxy-2,3-dihydropyran-6-one.
| Compound Name | (2S)-2-[(2S,3E,5Z)-6-iodo-4-methylhexa-3,5-dien-2-yl]-5-methoxy-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 59202258 |
| Molecular Formula | C13H17IO3 |
| Molecular Weight | 348.18 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | (2S)-2-[(2S,3E,5Z)-6-iodo-4-methylhexa-3,5-dien-2-yl]-5-methoxy-2,3-dihydropyran-6-one |
| SMILES | COC1=CC[C@@H]([C@@H](C)/C=C(C)/C=C\I)OC1=O |
| InChI | InChI=1S/C13H17IO3/c1-9(6-7-14)8-10(2)11-4-5-12(16-3)13(15)17-11/h5-8,10-11H,4H2,1-3H3/b7-6-,9-8+/t10-,11-/m0/s1 |
| InChIKey | PCQSEGAJVJGHSU-JHGQCBIDSA-N |
| XLogP | 3.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.18 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|