C24H41N5O5 — CID 59202466
N-[2-(diethylamino)ethyl]-2-[methyl-[1-[6-[(3R)-3-methyl-2,5-dioxopyrrolidin-1-yl]hexyl]-2,5-dioxopyrrolidin-3-yl]amino]acetamide (PubChem CID 59202466) has the molecular formula C24H41N5O5 and a molecular weight of 479.62 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-[methyl-[1-[6-[(3R)-3-methyl-2,5-dioxopyrrolidin-1-yl]hexyl]-2,5-dioxopyrrolidin-3-yl]amino]acetamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-[methyl-[1-[6-[(3R)-3-methyl-2,5-dioxopyrrolidin-1-yl]hexyl]-2,5-dioxopyrrolidin-3-yl]amino]acetamide |
|---|---|
| PubChem CID | 59202466 |
| Molecular Formula | C24H41N5O5 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-[methyl-[1-[6-[(3R)-3-methyl-2,5-dioxopyrrolidin-1-yl]hexyl]-2,5-dioxopyrrolidin-3-yl]amino]acetamide |
| SMILES | CCN(CC)CCNC(=O)CN(C)C1CC(=O)N(CCCCCCN2C(=O)C[C@@H](C)C2=O)C1=O |
| InChI | InChI=1S/C24H41N5O5/c1-5-27(6-2)14-11-25-20(30)17-26(4)19-16-22(32)29(24(19)34)13-10-8-7-9-12-28-21(31)15-18(3)23(28)33/h18-19H,5-17H2,1-4H3,(H,25,30)/t18-,19?/m1/s1 |
| InChIKey | ROTFSCZRVODJQC-MRTLOADZSA-N |
| XLogP | 0.46 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|