C27H38O3 — CID 59202710
(8R,9S,10R,13S,14S)-10,13-dimethyl-4,4-bis(prop-2-enyl)spiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-one (PubChem CID 59202710) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethyl-4,4-bis(prop-2-enyl)spiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-one.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-4,4-bis(prop-2-enyl)spiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-one |
|---|---|
| PubChem CID | 59202710 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-4,4-bis(prop-2-enyl)spiro[1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-one |
| SMILES | C=CCC1(CC=C)C(=O)CC[C@@]2(C)C1=CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CCC21OCCO1 |
| InChI | InChI=1S/C27H38O3/c1-5-12-26(13-6-2)22-8-7-19-20(24(22,3)14-11-23(26)28)9-15-25(4)21(19)10-16-27(25)29-17-18-30-27/h5-6,8,19-21H,1-2,7,9-18H2,3-4H3/t19-,20+,21+,24-,25+/m1/s1 |
| InChIKey | FQFOYLNLBMPFRW-HXOCAIRYSA-N |
| XLogP | 6.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|