C25H34F3N5O3S — CID 59202918
N-[3-[2-[2-[2-cyano-3-oxo-3-(2,2,2-trifluoroethylamino)propyl]-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]ethylamino]phenyl]-N,2,2-trimethylpropanamide (PubChem CID 59202918) has the molecular formula C25H34F3N5O3S and a molecular weight of 541.64 g/mol. Its IUPAC name is N-[3-[2-[2-[2-cyano-3-oxo-3-(2,2,2-trifluoroethylamino)propyl]-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]ethylamino]phenyl]-N,2,2-trimethylpropanamide.
| Compound Name | N-[3-[2-[2-[2-cyano-3-oxo-3-(2,2,2-trifluoroethylamino)propyl]-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]ethylamino]phenyl]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 59202918 |
| Molecular Formula | C25H34F3N5O3S |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | N-[3-[2-[2-[2-cyano-3-oxo-3-(2,2,2-trifluoroethylamino)propyl]-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]ethylamino]phenyl]-N,2,2-trimethylpropanamide |
| SMILES | CCN1C(=O)C(CCNc2cccc(N(C)C(=O)C(C)(C)C)c2)SC1CC(C#N)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C25H34F3N5O3S/c1-6-33-20(12-16(14-29)21(34)31-15-25(26,27)28)37-19(22(33)35)10-11-30-17-8-7-9-18(13-17)32(5)23(36)24(2,3)4/h7-9,13,16,19-20,30H,6,10-12,15H2,1-5H3,(H,31,34) |
| InChIKey | ROSIFQWWYOTZAY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |