C19H20FN3O7S — CID 59203439
N-[1-[(2R,4S,5R)-3-fluoro-3-methyl-4-methylperoxysulfanyloxy-5-(2-oxoethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 59203439) has the molecular formula C19H20FN3O7S and a molecular weight of 453.45 g/mol. Its IUPAC name is N-[1-[(2R,4S,5R)-3-fluoro-3-methyl-4-methylperoxysulfanyloxy-5-(2-oxoethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,4S,5R)-3-fluoro-3-methyl-4-methylperoxysulfanyloxy-5-(2-oxoethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 59203439 |
| Molecular Formula | C19H20FN3O7S |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | N-[1-[(2R,4S,5R)-3-fluoro-3-methyl-4-methylperoxysulfanyloxy-5-(2-oxoethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | COOSO[C@H]1[C@@H](CC=O)O[C@@H](n2ccc(NC(=O)c3ccccc3)nc2=O)C1(C)F |
| InChI | InChI=1S/C19H20FN3O7S/c1-19(20)15(29-31-30-27-2)13(9-11-24)28-17(19)23-10-8-14(22-18(23)26)21-16(25)12-6-4-3-5-7-12/h3-8,10-11,13,15,17H,9H2,1-2H3,(H,21,22,25,26)/t13-,15+,17-,19?/m1/s1 |
| InChIKey | XJLGRTASMWGXFT-PLXLDXEGSA-N |
| XLogP | 2.24 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|