About 3-(hydroxymethyl)-4,4-dimethylpyrrolidin-2-one
3-(hydroxymethyl)-4,4-dimethylpyrrolidin-2-one (PubChem CID 59203711) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 3-(hydroxymethyl)-4,4-dimethylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-(hydroxymethyl)-4,4-dimethylpyrrolidin-2-one |
| PubChem CID | 59203711 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 3-(hydroxymethyl)-4,4-dimethylpyrrolidin-2-one |
| SMILES | CC1(C)CNC(=O)C1CO |
| InChI | InChI=1S/C7H13NO2/c1-7(2)4-8-6(10)5(7)3-9/h5,9H,3-4H2,1-2H3,(H,8,10) |
| InChIKey | OYCQTOVZPKPUHP-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(hydroxymethyl)-4,4-dimethylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxymethyl)-4,4-dimethylpyrrolidin-2-one?
The IUPAC name of 3-(hydroxymethyl)-4,4-dimethylpyrrolidin-2-one (CID 59203711) is 3-(hydroxymethyl)-4,4-dimethylpyrrolidin-2-one.
What is the SMILES notation for 3-(hydroxymethyl)-4,4-dimethylpyrrolidin-2-one?
The canonical SMILES for 3-(hydroxymethyl)-4,4-dimethylpyrrolidin-2-one is CC1(C)CNC(=O)C1CO.
What is the InChIKey of 3-(hydroxymethyl)-4,4-dimethylpyrrolidin-2-one?
The InChIKey is OYCQTOVZPKPUHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-7(2)4-8-6(10)5(7)3-9/h5,9H,3-4H2,1-2H3,(H,8,10).
What are the key properties of 3-(hydroxymethyl)-4,4-dimethylpyrrolidin-2-one?
3-(hydroxymethyl)-4,4-dimethylpyrrolidin-2-one has a molecular weight of 143.19 g/mol, XLogP of -0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethyl)-4,4-dimethylpyrrolidin-2-one is sourced from PubChem (CID 59203711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).