About ethyl 5-(bromomethyl)-2,3-dihydrofuran-4-carboxylate
ethyl 5-(bromomethyl)-2,3-dihydrofuran-4-carboxylate (PubChem CID 59203731) has the molecular formula C8H11BrO3
and a molecular weight of 235.08 g/mol. Its IUPAC name is ethyl 5-(bromomethyl)-2,3-dihydrofuran-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(bromomethyl)-2,3-dihydrofuran-4-carboxylate |
| PubChem CID | 59203731 |
| Molecular Formula | C8H11BrO3 |
| Molecular Weight | 235.08 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | ethyl 5-(bromomethyl)-2,3-dihydrofuran-4-carboxylate |
| SMILES | CCOC(=O)C1=C(CBr)OCC1 |
| InChI | InChI=1S/C8H11BrO3/c1-2-11-8(10)6-3-4-12-7(6)5-9/h2-5H2,1H3 |
| InChIKey | XUPDHJVNSNYNMB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.08 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-(bromomethyl)-2,3-dihydrofuran-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(bromomethyl)-2,3-dihydrofuran-4-carboxylate?
The IUPAC name of ethyl 5-(bromomethyl)-2,3-dihydrofuran-4-carboxylate (CID 59203731) is ethyl 5-(bromomethyl)-2,3-dihydrofuran-4-carboxylate.
What is the SMILES notation for ethyl 5-(bromomethyl)-2,3-dihydrofuran-4-carboxylate?
The canonical SMILES for ethyl 5-(bromomethyl)-2,3-dihydrofuran-4-carboxylate is CCOC(=O)C1=C(CBr)OCC1.
What is the InChIKey of ethyl 5-(bromomethyl)-2,3-dihydrofuran-4-carboxylate?
The InChIKey is XUPDHJVNSNYNMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrO3/c1-2-11-8(10)6-3-4-12-7(6)5-9/h2-5H2,1H3.
What are the key properties of ethyl 5-(bromomethyl)-2,3-dihydrofuran-4-carboxylate?
ethyl 5-(bromomethyl)-2,3-dihydrofuran-4-carboxylate has a molecular weight of 235.08 g/mol, XLogP of 1.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(bromomethyl)-2,3-dihydrofuran-4-carboxylate is sourced from PubChem (CID 59203731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).