C22H36O7 — CID 59203898
[4,5-dihydroxy-2-methyl-6-[(3S)-3-methylpent-1-en-3-yl]oxyoxan-3-yl] (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate (PubChem CID 59203898) has the molecular formula C22H36O7 and a molecular weight of 412.52 g/mol. Its IUPAC name is [4,5-dihydroxy-2-methyl-6-[(3S)-3-methylpent-1-en-3-yl]oxyoxan-3-yl] (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate.
| Compound Name | [4,5-dihydroxy-2-methyl-6-[(3S)-3-methylpent-1-en-3-yl]oxyoxan-3-yl] (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate |
|---|---|
| PubChem CID | 59203898 |
| Molecular Formula | C22H36O7 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | [4,5-dihydroxy-2-methyl-6-[(3S)-3-methylpent-1-en-3-yl]oxyoxan-3-yl] (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate |
| SMILES | C=CC(C)(O)CC/C=C(\C)C(=O)OC1C(C)OC(O[C@](C)(C=C)CC)C(O)C1O |
| InChI | InChI=1S/C22H36O7/c1-8-21(6,26)13-11-12-14(4)19(25)28-18-15(5)27-20(17(24)16(18)23)29-22(7,9-2)10-3/h8-9,12,15-18,20,23-24,26H,1-2,10-11,13H2,3-7H3/b14-12+/t15?,16?,17?,18?,20?,21?,22-/m1/s1 |
| InChIKey | GUCDTJHPPWPFQO-RPRSPHHTSA-N |
| XLogP | 2.40 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|