C7H9F7O — CID 59203903
1,1,1,4,5,5-hexafluoro-4-(fluoromethoxy)hexane (PubChem CID 59203903) has the molecular formula C7H9F7O and a molecular weight of 242.13 g/mol. Its IUPAC name is 1,1,1,4,5,5-hexafluoro-4-(fluoromethoxy)hexane.
| Compound Name | 1,1,1,4,5,5-hexafluoro-4-(fluoromethoxy)hexane |
|---|---|
| PubChem CID | 59203903 |
| Molecular Formula | C7H9F7O |
| Molecular Weight | 242.13 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 1,1,1,4,5,5-hexafluoro-4-(fluoromethoxy)hexane |
| SMILES | CC(F)(F)C(F)(CCC(F)(F)F)OCF |
| InChI | InChI=1S/C7H9F7O/c1-5(9,10)6(11,15-4-8)2-3-7(12,13)14/h2-4H2,1H3 |
| InChIKey | RDGSQSPSFXOHNZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.13 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |