C33H24N12 — CID 59203920
2-N,2-N,4-N,4-N,6-N,6-N-hexapyridin-2-yl-1,3,5-triazine-2,4,6-triamine (PubChem CID 59203920) has the molecular formula C33H24N12 and a molecular weight of 588.64 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,6-N,6-N-hexapyridin-2-yl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexapyridin-2-yl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 59203920 |
| Molecular Formula | C33H24N12 |
| Molecular Weight | 588.64 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexapyridin-2-yl-1,3,5-triazine-2,4,6-triamine |
| SMILES | c1ccc(N(c2ccccn2)c2nc(N(c3ccccn3)c3ccccn3)nc(N(c3ccccn3)c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C33H24N12/c1-7-19-34-25(13-1)43(26-14-2-8-20-35-26)31-40-32(44(27-15-3-9-21-36-27)28-16-4-10-22-37-28)42-33(41-31)45(29-17-5-11-23-38-29)30-18-6-12-24-39-30/h1-24H |
| InChIKey | FWFXVDFURKHUFN-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 125.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.64 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |