C21H29F3O3 — CID 59203942
oxan-2-yl 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 59203942) has the molecular formula C21H29F3O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is oxan-2-yl 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | oxan-2-yl 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 59203942 |
| Molecular Formula | C21H29F3O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | oxan-2-yl 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC1C(C)C2CC1C1C3CC(C21)C(C(=O)OC1CCCCO1)(C(F)(F)F)C3 |
| InChI | InChI=1S/C21H29F3O3/c1-10-11(2)14-8-13(10)17-12-7-15(18(14)17)20(9-12,21(22,23)24)19(25)27-16-5-3-4-6-26-16/h10-18H,3-9H2,1-2H3 |
| InChIKey | QQQDSDHQFUARNM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|