C11H16F7NO — CID 59203986
1-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethyl]piperidine (PubChem CID 59203986) has the molecular formula C11H16F7NO and a molecular weight of 311.24 g/mol. Its IUPAC name is 1-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethyl]piperidine.
| Compound Name | 1-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethyl]piperidine |
|---|---|
| PubChem CID | 59203986 |
| Molecular Formula | C11H16F7NO |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethyl]piperidine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)COCCN1CCCCC1 |
| InChI | InChI=1S/C11H16F7NO/c12-9(13,10(14,15)11(16,17)18)8-20-7-6-19-4-2-1-3-5-19/h1-8H2 |
| InChIKey | DZKAKJKZXVZSGA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|