C12H17F8NO — CID 59204081
1-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]piperidine (PubChem CID 59204081) has the molecular formula C12H17F8NO and a molecular weight of 343.26 g/mol. Its IUPAC name is 1-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]piperidine.
| Compound Name | 1-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]piperidine |
|---|---|
| PubChem CID | 59204081 |
| Molecular Formula | C12H17F8NO |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]piperidine |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)COCCN1CCCCC1 |
| InChI | InChI=1S/C12H17F8NO/c13-9(14)11(17,18)12(19,20)10(15,16)8-22-7-6-21-4-2-1-3-5-21/h9H,1-8H2 |
| InChIKey | OZLQWMCCMYBNKL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|