C15H22F7NO2 — CID 59204087
(4,4,5,5,6,6,6-heptafluoro-2-methylhexan-3-yl) 3-piperidin-1-ylpropanoate (PubChem CID 59204087) has the molecular formula C15H22F7NO2 and a molecular weight of 381.33 g/mol. Its IUPAC name is (4,4,5,5,6,6,6-heptafluoro-2-methylhexan-3-yl) 3-piperidin-1-ylpropanoate.
| Compound Name | (4,4,5,5,6,6,6-heptafluoro-2-methylhexan-3-yl) 3-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 59204087 |
| Molecular Formula | C15H22F7NO2 |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (4,4,5,5,6,6,6-heptafluoro-2-methylhexan-3-yl) 3-piperidin-1-ylpropanoate |
| SMILES | CC(C)C(OC(=O)CCN1CCCCC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H22F7NO2/c1-10(2)12(13(16,17)14(18,19)15(20,21)22)25-11(24)6-9-23-7-4-3-5-8-23/h10,12H,3-9H2,1-2H3 |
| InChIKey | YZGAJDGGIDXYLB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|