C15H23F8NO — CID 59204110
1-[2-(4,4,5,5,6,6,7,7-octafluoro-2-methylheptan-3-yl)oxyethyl]piperidine (PubChem CID 59204110) has the molecular formula C15H23F8NO and a molecular weight of 385.34 g/mol. Its IUPAC name is 1-[2-(4,4,5,5,6,6,7,7-octafluoro-2-methylheptan-3-yl)oxyethyl]piperidine.
| Compound Name | 1-[2-(4,4,5,5,6,6,7,7-octafluoro-2-methylheptan-3-yl)oxyethyl]piperidine |
|---|---|
| PubChem CID | 59204110 |
| Molecular Formula | C15H23F8NO |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 1-[2-(4,4,5,5,6,6,7,7-octafluoro-2-methylheptan-3-yl)oxyethyl]piperidine |
| SMILES | CC(C)C(OCCN1CCCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H23F8NO/c1-10(2)11(25-9-8-24-6-4-3-5-7-24)13(18,19)15(22,23)14(20,21)12(16)17/h10-12H,3-9H2,1-2H3 |
| InChIKey | KOXUIRHDGQOAQF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|